C17H15FN2O4 — CID 95179512
N-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenoxy)acetamide (PubChem CID 95179512) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is N-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenoxy)acetamide.
| Compound Name | N-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 95179512 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[(1S,2S)-2-(3-fluorophenyl)cyclopropyl]-2-(3-nitrophenoxy)acetamide |
| SMILES | O=C(COc1cccc([N+](=O)[O-])c1)N[C@H]1C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H15FN2O4/c18-12-4-1-3-11(7-12)15-9-16(15)19-17(21)10-24-14-6-2-5-13(8-14)20(22)23/h1-8,15-16H,9-10H2,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | FGFXIPMBRDUNHC-HOTGVXAUSA-N |
| XLogP | 2.79 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|