C16H19N5O3 — CID 120634843
(2S,4S)-2-methyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]piperidine-4-carboxamide (PubChem CID 120634843) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120634843 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | (2S,4S)-2-methyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]piperidine-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](C(=O)Nc2cc(-c3cccc([N+](=O)[O-])c3)[nH]n2)CCN1 |
| InChI | InChI=1S/C16H19N5O3/c1-10-7-12(5-6-17-10)16(22)18-15-9-14(19-20-15)11-3-2-4-13(8-11)21(23)24/h2-4,8-10,12,17H,5-7H2,1H3,(H2,18,19,20,22)/t10-,12-/m0/s1 |
| InChIKey | MMHNARKUWUQYFV-JQWIXIFHSA-N |
| XLogP | 2.31 |
| TPSA | 112.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|