C17H20N4O4 — CID 99782280
(2R,4R)-2-ethyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxane-4-carboxamide (PubChem CID 99782280) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxane-4-carboxamide.
| Compound Name | (2R,4R)-2-ethyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 99782280 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (2R,4R)-2-ethyl-N-[5-(3-nitrophenyl)-1H-pyrazol-3-yl]oxane-4-carboxamide |
| SMILES | CC[C@@H]1C[C@H](C(=O)Nc2cc(-c3cccc([N+](=O)[O-])c3)[nH]n2)CCO1 |
| InChI | InChI=1S/C17H20N4O4/c1-2-14-9-12(6-7-25-14)17(22)18-16-10-15(19-20-16)11-4-3-5-13(8-11)21(23)24/h3-5,8,10,12,14H,2,6-7,9H2,1H3,(H2,18,19,20,22)/t12-,14-/m1/s1 |
| InChIKey | VADUOIWFKOFJIG-TZMCWYRMSA-N |
| XLogP | 3.13 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|