C17H21N5O3 — CID 95284329
1-[(2R)-2-ethylpiperidin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone (PubChem CID 95284329) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[(2R)-2-ethylpiperidin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone |
|---|---|
| PubChem CID | 95284329 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(2R)-2-ethylpiperidin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone |
| SMILES | CC[C@@H]1CCCCN1C(=O)Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H21N5O3/c1-2-14-7-3-4-9-21(14)16(23)11-20-12-18-17(19-20)13-6-5-8-15(10-13)22(24)25/h5-6,8,10,12,14H,2-4,7,9,11H2,1H3/t14-/m1/s1 |
| InChIKey | RSTZYKPFEQEOPK-CQSZACIVSA-N |
| XLogP | 2.64 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|