C23H24N4O3 — CID 54520303
1-(2-ethylpiperidin-1-yl)-3-[2-(3-nitrophenyl)pyrazolo[1,5-a]pyridin-3-yl]prop-2-en-1-one (PubChem CID 54520303) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-(2-ethylpiperidin-1-yl)-3-[2-(3-nitrophenyl)pyrazolo[1,5-a]pyridin-3-yl]prop-2-en-1-one.
| Compound Name | 1-(2-ethylpiperidin-1-yl)-3-[2-(3-nitrophenyl)pyrazolo[1,5-a]pyridin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 54520303 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-(2-ethylpiperidin-1-yl)-3-[2-(3-nitrophenyl)pyrazolo[1,5-a]pyridin-3-yl]prop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)C=Cc1c(-c2cccc([N+](=O)[O-])c2)nn2ccccc12 |
| InChI | InChI=1S/C23H24N4O3/c1-2-18-9-3-5-14-25(18)22(28)13-12-20-21-11-4-6-15-26(21)24-23(20)17-8-7-10-19(16-17)27(29)30/h4,6-8,10-13,15-16,18H,2-3,5,9,14H2,1H3 |
| InChIKey | YPIKDZDZMTYOBK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|