C12H17N3O2 — CID 97309238
(2R,4R)-2-ethyl-N-pyrazin-2-yloxane-4-carboxamide (PubChem CID 97309238) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-N-pyrazin-2-yloxane-4-carboxamide.
| Compound Name | (2R,4R)-2-ethyl-N-pyrazin-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 97309238 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (2R,4R)-2-ethyl-N-pyrazin-2-yloxane-4-carboxamide |
| SMILES | CC[C@@H]1C[C@H](C(=O)Nc2cnccn2)CCO1 |
| InChI | InChI=1S/C12H17N3O2/c1-2-10-7-9(3-6-17-10)12(16)15-11-8-13-4-5-14-11/h4-5,8-10H,2-3,6-7H2,1H3,(H,14,15,16)/t9-,10-/m1/s1 |
| InChIKey | JYLVWLFSDXHLGR-NXEZZACHSA-N |
| XLogP | 1.62 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |