C13H22N4O — CID 108893837
1,1-dibutyl-3-pyrazin-2-ylurea (PubChem CID 108893837) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 1,1-dibutyl-3-pyrazin-2-ylurea.
| Compound Name | 1,1-dibutyl-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 108893837 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 1,1-dibutyl-3-pyrazin-2-ylurea |
| SMILES | CCCCN(CCCC)C(=O)Nc1cnccn1 |
| InChI | InChI=1S/C13H22N4O/c1-3-5-9-17(10-6-4-2)13(18)16-12-11-14-7-8-15-12/h7-8,11H,3-6,9-10H2,1-2H3,(H,15,16,18) |
| InChIKey | SCRMXNZGWVDOJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |