C24H32N6O — CID 137401244
1-[(2Z,4Z)-3-amino-6-(4-methyl-3-pyridinyl)hepta-2,4,6-trien-2-yl]-1-hexyl-3-pyrazin-2-ylurea (PubChem CID 137401244) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-[(2Z,4Z)-3-amino-6-(4-methyl-3-pyridinyl)hepta-2,4,6-trien-2-yl]-1-hexyl-3-pyrazin-2-ylurea.
| Compound Name | 1-[(2Z,4Z)-3-amino-6-(4-methyl-3-pyridinyl)hepta-2,4,6-trien-2-yl]-1-hexyl-3-pyrazin-2-ylurea |
|---|---|
| PubChem CID | 137401244 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 1-[(2Z,4Z)-3-amino-6-(4-methyl-3-pyridinyl)hepta-2,4,6-trien-2-yl]-1-hexyl-3-pyrazin-2-ylurea |
| SMILES | C=C(/C=C\C(N)=C(/C)N(CCCCCC)C(=O)Nc1cnccn1)c1cnccc1C |
| InChI | InChI=1S/C24H32N6O/c1-5-6-7-8-15-30(24(31)29-23-17-27-13-14-28-23)20(4)22(25)10-9-18(2)21-16-26-12-11-19(21)3/h9-14,16-17H,2,5-8,15,25H2,1,3-4H3,(H,28,29,31)/b10-9-,22-20- |
| InChIKey | KKGFVKNRWOIETN-VTXWUOQCSA-N |
| XLogP | 5.05 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|