C12H18N4O2 — CID 75508705
N',N'-diethyl-N-pyrazin-2-ylbutanediamide (PubChem CID 75508705) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is N',N'-diethyl-N-pyrazin-2-ylbutanediamide.
| Compound Name | N',N'-diethyl-N-pyrazin-2-ylbutanediamide |
|---|---|
| PubChem CID | 75508705 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N',N'-diethyl-N-pyrazin-2-ylbutanediamide |
| SMILES | CCN(CC)C(=O)CCC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C12H18N4O2/c1-3-16(4-2)12(18)6-5-11(17)15-10-9-13-7-8-14-10/h7-9H,3-6H2,1-2H3,(H,14,15,17) |
| InChIKey | BHXBCWUAOOEFJQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |