C16H22N4OS — CID 143235359
ethane;N-pyrazin-2-yl-1-thiophen-2-ylpiperidine-4-carboxamide (PubChem CID 143235359) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is ethane;N-pyrazin-2-yl-1-thiophen-2-ylpiperidine-4-carboxamide.
| Compound Name | ethane;N-pyrazin-2-yl-1-thiophen-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 143235359 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | ethane;N-pyrazin-2-yl-1-thiophen-2-ylpiperidine-4-carboxamide |
| SMILES | CC.O=C(Nc1cnccn1)C1CCN(c2cccs2)CC1 |
| InChI | InChI=1S/C14H16N4OS.C2H6/c19-14(17-12-10-15-5-6-16-12)11-3-7-18(8-4-11)13-2-1-9-20-13;1-2/h1-2,5-6,9-11H,3-4,7-8H2,(H,16,17,19);1-2H3 |
| InChIKey | WKTFIKOIUCFKFL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |