C17H20N4O3S — CID 124705094
(3S)-3-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]-3-thiophen-2-ylpropanoic acid (PubChem CID 124705094) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is (3S)-3-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | (3S)-3-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 124705094 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3S)-3-[(1-pyrazin-2-ylpiperidine-4-carbonyl)amino]-3-thiophen-2-ylpropanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)C1CCN(c2cnccn2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H20N4O3S/c22-16(23)10-13(14-2-1-9-25-14)20-17(24)12-3-7-21(8-4-12)15-11-18-5-6-19-15/h1-2,5-6,9,11-13H,3-4,7-8,10H2,(H,20,24)(H,22,23)/t13-/m0/s1 |
| InChIKey | WIJBKHZXPCREIW-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |