C21H29N5OS — CID 83273239
1-(4-pyrrolidin-1-ylpyrimidin-5-yl)-N-(1-thiophen-2-ylpropyl)piperidine-4-carboxamide (PubChem CID 83273239) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-(4-pyrrolidin-1-ylpyrimidin-5-yl)-N-(1-thiophen-2-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-pyrrolidin-1-ylpyrimidin-5-yl)-N-(1-thiophen-2-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 83273239 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-(4-pyrrolidin-1-ylpyrimidin-5-yl)-N-(1-thiophen-2-ylpropyl)piperidine-4-carboxamide |
| SMILES | CCC(NC(=O)C1CCN(c2cncnc2N2CCCC2)CC1)c1cccs1 |
| InChI | InChI=1S/C21H29N5OS/c1-2-17(19-6-5-13-28-19)24-21(27)16-7-11-25(12-8-16)18-14-22-15-23-20(18)26-9-3-4-10-26/h5-6,13-17H,2-4,7-12H2,1H3,(H,24,27) |
| InChIKey | JCRUZHUJNSOOCO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |