C10H15N3O2 — CID 106739982
2-methyl-N-(1,2-oxazol-3-yl)piperidine-4-carboxamide (PubChem CID 106739982) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-methyl-N-(1,2-oxazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 2-methyl-N-(1,2-oxazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 106739982 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-methyl-N-(1,2-oxazol-3-yl)piperidine-4-carboxamide |
| SMILES | CC1CC(C(=O)Nc2ccon2)CCN1 |
| InChI | InChI=1S/C10H15N3O2/c1-7-6-8(2-4-11-7)10(14)12-9-3-5-15-13-9/h3,5,7-8,11H,2,4,6H2,1H3,(H,12,13,14) |
| InChIKey | WANNYOVRGFPARE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |