C11H17N3O2 — CID 114428961
4-ethyl-N-(1,2-oxazol-3-yl)piperidine-2-carboxamide (PubChem CID 114428961) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-ethyl-N-(1,2-oxazol-3-yl)piperidine-2-carboxamide.
| Compound Name | 4-ethyl-N-(1,2-oxazol-3-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114428961 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 4-ethyl-N-(1,2-oxazol-3-yl)piperidine-2-carboxamide |
| SMILES | CCC1CCNC(C(=O)Nc2ccon2)C1 |
| InChI | InChI=1S/C11H17N3O2/c1-2-8-3-5-12-9(7-8)11(15)13-10-4-6-16-14-10/h4,6,8-9,12H,2-3,5,7H2,1H3,(H,13,14,15) |
| InChIKey | KFQHWTVMOVFHAI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |