C22H29N3O7 — CID 141216790
1-[3-[ethyl(1-hydroxyethyl)amino]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid (PubChem CID 141216790) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is 1-[3-[ethyl(1-hydroxyethyl)amino]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid.
| Compound Name | 1-[3-[ethyl(1-hydroxyethyl)amino]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 141216790 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[3-[ethyl(1-hydroxyethyl)amino]propyl]-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridine-3,5-dicarboxylic acid |
| SMILES | CCN(CCCN1C(C)=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C1C)C(C)O |
| InChI | InChI=1S/C22H29N3O7/c1-5-23(15(4)26)10-7-11-24-13(2)18(21(27)28)20(19(14(24)3)22(29)30)16-8-6-9-17(12-16)25(31)32/h6,8-9,12,15,20,26H,5,7,10-11H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | GVNWOZIWJACNMS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 144.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|