C22H28N2NaO9S+ — CID 23666616
sodium 1-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-yl]propane-1-sulfonic acid (PubChem CID 23666616) has the molecular formula C22H28N2NaO9S+ and a molecular weight of 519.53 g/mol. Its IUPAC name is sodium 1-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-yl]propane-1-sulfonic acid.
| Compound Name | sodium 1-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 23666616 |
| Molecular Formula | C22H28N2NaO9S+ |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | sodium 1-[3,5-bis(ethoxycarbonyl)-2,6-dimethyl-4-(3-nitrophenyl)-4H-pyridin-1-yl]propane-1-sulfonic acid |
| SMILES | CCOC(=O)C1=C(C)N(C(CC)S(=O)(=O)O)C(C)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C22H28N2O9S.Na/c1-6-17(34(29,30)31)23-13(4)18(21(25)32-7-2)20(19(14(23)5)22(26)33-8-3)15-10-9-11-16(12-15)24(27)28;/h9-12,17,20H,6-8H2,1-5H3,(H,29,30,31);/q;+1 |
| InChIKey | UAHKLHKNIYXQEL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|