C25H23NO — CID 16655982
(E)-1-[(2R,3R)-1-benzhydryl-3-phenylaziridin-2-yl]but-2-en-1-one (PubChem CID 16655982) has the molecular formula C25H23NO and a molecular weight of 353.47 g/mol. Its IUPAC name is (E)-1-[(2R,3R)-1-benzhydryl-3-phenylaziridin-2-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(2R,3R)-1-benzhydryl-3-phenylaziridin-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 16655982 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (E)-1-[(2R,3R)-1-benzhydryl-3-phenylaziridin-2-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)[C@H]1[C@@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23NO/c1-2-12-22(27)25-24(21-17-10-5-11-18-21)26(25)23(19-13-6-3-7-14-19)20-15-8-4-9-16-20/h2-18,23-25H,1H3/b12-2+/t24-,25+,26?/m1/s1 |
| InChIKey | GECABISPFJPCET-GJRGWSDJSA-N |
| XLogP | 5.35 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|