C34H36N2O — CID 46914370
(2R,3R)-N-benzyl-1-[bis(3,5-dimethylphenyl)methyl]-N-methyl-3-phenylaziridine-2-carboxamide (PubChem CID 46914370) has the molecular formula C34H36N2O and a molecular weight of 488.68 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-1-[bis(3,5-dimethylphenyl)methyl]-N-methyl-3-phenylaziridine-2-carboxamide.
| Compound Name | (2R,3R)-N-benzyl-1-[bis(3,5-dimethylphenyl)methyl]-N-methyl-3-phenylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 46914370 |
| Molecular Formula | C34H36N2O |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (2R,3R)-N-benzyl-1-[bis(3,5-dimethylphenyl)methyl]-N-methyl-3-phenylaziridine-2-carboxamide |
| SMILES | Cc1cc(C)cc(C(c2cc(C)cc(C)c2)N2[C@H](c3ccccc3)[C@@H]2C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H36N2O/c1-23-16-24(2)19-29(18-23)31(30-20-25(3)17-26(4)21-30)36-32(28-14-10-7-11-15-28)33(36)34(37)35(5)22-27-12-8-6-9-13-27/h6-21,31-33H,22H2,1-5H3/t32-,33-,36?/m1/s1 |
| InChIKey | JTHYVVCCBDXWFT-CPKRCLNGSA-N |
| XLogP | 7.09 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|