C22H26N2O2 — CID 110086806
(2R,3R)-N-benzyl-1-ethyl-N-methyl-6-oxo-2-phenylpiperidine-3-carboxamide (PubChem CID 110086806) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2R,3R)-N-benzyl-1-ethyl-N-methyl-6-oxo-2-phenylpiperidine-3-carboxamide.
| Compound Name | (2R,3R)-N-benzyl-1-ethyl-N-methyl-6-oxo-2-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 110086806 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2R,3R)-N-benzyl-1-ethyl-N-methyl-6-oxo-2-phenylpiperidine-3-carboxamide |
| SMILES | CCN1C(=O)CC[C@@H](C(=O)N(C)Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N2O2/c1-3-24-20(25)15-14-19(21(24)18-12-8-5-9-13-18)22(26)23(2)16-17-10-6-4-7-11-17/h4-13,19,21H,3,14-16H2,1-2H3/t19-,21+/m1/s1 |
| InChIKey | GAPNDVZBENJBNX-CTNGQTDRSA-N |
| XLogP | 3.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |