C16H20NO3- — CID 7094966
(2R,3S)-1-butyl-6-oxo-2-phenylpiperidine-3-carboxylate (PubChem CID 7094966) has the molecular formula C16H20NO3- and a molecular weight of 274.34 g/mol. Its IUPAC name is (2R,3S)-1-butyl-6-oxo-2-phenylpiperidine-3-carboxylate.
| Compound Name | (2R,3S)-1-butyl-6-oxo-2-phenylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7094966 |
| Molecular Formula | C16H20NO3- |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (2R,3S)-1-butyl-6-oxo-2-phenylpiperidine-3-carboxylate |
| SMILES | CCCCN1C(=O)CC[C@H](C(=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-2-3-11-17-14(18)10-9-13(16(19)20)15(17)12-7-5-4-6-8-12/h4-8,13,15H,2-3,9-11H2,1H3,(H,19,20)/p-1/t13-,15-/m0/s1 |
| InChIKey | KHXCQUSPYYEVLX-ZFWWWQNUSA-M |
| XLogP | 1.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |