C15H18NO4- — CID 7188451
(2S,3R)-1-ethyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate (PubChem CID 7188451) has the molecular formula C15H18NO4- and a molecular weight of 276.31 g/mol. Its IUPAC name is (2S,3R)-1-ethyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate.
| Compound Name | (2S,3R)-1-ethyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 7188451 |
| Molecular Formula | C15H18NO4- |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2S,3R)-1-ethyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxylate |
| SMILES | CCN1C(=O)CC[C@@H](C(=O)[O-])[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H19NO4/c1-3-16-13(17)9-8-12(15(18)19)14(16)10-4-6-11(20-2)7-5-10/h4-7,12,14H,3,8-9H2,1-2H3,(H,18,19)/p-1/t12-,14-/m1/s1 |
| InChIKey | OOEQVBQHJUONDC-TZMCWYRMSA-M |
| XLogP | 0.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |