C21H33N3O5 — CID 171688374
(2R,3R)-N-[2-(dimethylamino)ethyl]-2-(4-ethoxyphenyl)-1-ethyl-6-oxopiperidine-3-carboxamide;formic acid (PubChem CID 171688374) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is (2R,3R)-N-[2-(dimethylamino)ethyl]-2-(4-ethoxyphenyl)-1-ethyl-6-oxopiperidine-3-carboxamide;formic acid.
| Compound Name | (2R,3R)-N-[2-(dimethylamino)ethyl]-2-(4-ethoxyphenyl)-1-ethyl-6-oxopiperidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 171688374 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (2R,3R)-N-[2-(dimethylamino)ethyl]-2-(4-ethoxyphenyl)-1-ethyl-6-oxopiperidine-3-carboxamide;formic acid |
| SMILES | CCOc1ccc(C2[C@H](C(=O)NCCN(C)C)CCC(=O)N2CC)cc1.O=CO |
| InChI | InChI=1S/C20H31N3O3.CH2O2/c1-5-23-18(24)12-11-17(20(25)21-13-14-22(3)4)19(23)15-7-9-16(10-8-15)26-6-2;2-1-3/h7-10,17,19H,5-6,11-14H2,1-4H3,(H,21,25);1H,(H,2,3)/t17-,19?;/m1./s1 |
| InChIKey | CTIHIBOLDHHBHI-OWXCZVATSA-N |
| XLogP | 1.76 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|