C14H16NO4- — CID 7144611
(2R,3R)-1-(2-methoxyethyl)-5-oxo-2-phenylpyrrolidine-3-carboxylate (PubChem CID 7144611) has the molecular formula C14H16NO4- and a molecular weight of 262.28 g/mol. Its IUPAC name is (2R,3R)-1-(2-methoxyethyl)-5-oxo-2-phenylpyrrolidine-3-carboxylate.
| Compound Name | (2R,3R)-1-(2-methoxyethyl)-5-oxo-2-phenylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7144611 |
| Molecular Formula | C14H16NO4- |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2R,3R)-1-(2-methoxyethyl)-5-oxo-2-phenylpyrrolidine-3-carboxylate |
| SMILES | COCCN1C(=O)C[C@@H](C(=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-19-8-7-15-12(16)9-11(14(17)18)13(15)10-5-3-2-4-6-10/h2-6,11,13H,7-9H2,1H3,(H,17,18)/p-1/t11-,13+/m1/s1 |
| InChIKey | LWLDIFNJOLYNQS-YPMHNXCESA-M |
| XLogP | -0.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |