About (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide
(2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide (PubChem CID 110087249) has the molecular formula C18H26N2O4
and a molecular weight of 334.42 g/mol. Its IUPAC name is (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
| PubChem CID | 110087249 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide |
| SMILES | COCCN(C)C(=O)[C@@H]1CC(=O)N(CCOC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4/c1-19(9-11-23-2)18(22)15-13-16(21)20(10-12-24-3)17(15)14-7-5-4-6-8-14/h4-8,15,17H,9-13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | IZIHPRDJEQWQLR-WBVHZDCISA-N |
| XLogP | 1.33 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide?
The IUPAC name of (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide (CID 110087249) is (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide.
What is the SMILES notation for (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide?
The canonical SMILES for (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide is COCCN(C)C(=O)[C@@H]1CC(=O)N(CCOC)[C@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide?
The InChIKey is IZIHPRDJEQWQLR-WBVHZDCISA-N. The full InChI is InChI=1S/C18H26N2O4/c1-19(9-11-23-2)18(22)15-13-16(21)20(10-12-24-3)17(15)14-7-5-4-6-8-14/h4-8,15,17H,9-13H2,1-3H3/t15-,17+/m1/s1.
What are the key properties of (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide?
(2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide has a molecular weight of 334.42 g/mol, XLogP of 1.33, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-N,1-bis(2-methoxyethyl)-N-methyl-5-oxo-2-phenylpyrrolidine-3-carboxamide is sourced from PubChem (CID 110087249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).