C22H27NOS — CID 95091830
(5S,6R)-1-butyl-5-(4-methylphenyl)sulfanyl-6-phenylpiperidin-2-one (PubChem CID 95091830) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is (5S,6R)-1-butyl-5-(4-methylphenyl)sulfanyl-6-phenylpiperidin-2-one.
| Compound Name | (5S,6R)-1-butyl-5-(4-methylphenyl)sulfanyl-6-phenylpiperidin-2-one |
|---|---|
| PubChem CID | 95091830 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (5S,6R)-1-butyl-5-(4-methylphenyl)sulfanyl-6-phenylpiperidin-2-one |
| SMILES | CCCCN1C(=O)CC[C@H](Sc2ccc(C)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H27NOS/c1-3-4-16-23-21(24)15-14-20(22(23)18-8-6-5-7-9-18)25-19-12-10-17(2)11-13-19/h5-13,20,22H,3-4,14-16H2,1-2H3/t20-,22+/m0/s1 |
| InChIKey | BJNJORPGGUCFBV-RBBKRZOGSA-N |
| XLogP | 5.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |