C18H21NO2S2 — CID 10521627
(3R,4R)-2-butyl-3-phenyl-4-phenylsulfanylthiazetidine 1,1-dioxide (PubChem CID 10521627) has the molecular formula C18H21NO2S2 and a molecular weight of 347.50 g/mol. Its IUPAC name is (3R,4R)-2-butyl-3-phenyl-4-phenylsulfanylthiazetidine 1,1-dioxide.
| Compound Name | (3R,4R)-2-butyl-3-phenyl-4-phenylsulfanylthiazetidine 1,1-dioxide |
|---|---|
| PubChem CID | 10521627 |
| Molecular Formula | C18H21NO2S2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3R,4R)-2-butyl-3-phenyl-4-phenylsulfanylthiazetidine 1,1-dioxide |
| SMILES | CCCCN1[C@H](c2ccccc2)[C@H](Sc2ccccc2)S1(=O)=O |
| InChI | InChI=1S/C18H21NO2S2/c1-2-3-14-19-17(15-10-6-4-7-11-15)18(23(19,20)21)22-16-12-8-5-9-13-16/h4-13,17-18H,2-3,14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | CZBWVEKIKNMCRB-QZTJIDSGSA-N |
| XLogP | 4.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |