C21H25NOS — CID 95091827
(5S,6S)-1-butyl-6-phenyl-5-phenylsulfanylpiperidin-2-one (PubChem CID 95091827) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (5S,6S)-1-butyl-6-phenyl-5-phenylsulfanylpiperidin-2-one.
| Compound Name | (5S,6S)-1-butyl-6-phenyl-5-phenylsulfanylpiperidin-2-one |
|---|---|
| PubChem CID | 95091827 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (5S,6S)-1-butyl-6-phenyl-5-phenylsulfanylpiperidin-2-one |
| SMILES | CCCCN1C(=O)CC[C@H](Sc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25NOS/c1-2-3-16-22-20(23)15-14-19(24-18-12-8-5-9-13-18)21(22)17-10-6-4-7-11-17/h4-13,19,21H,2-3,14-16H2,1H3/t19-,21-/m0/s1 |
| InChIKey | WHLHRHFMMSWCOI-FPOVZHCZSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |