C25H32N2O2 — CID 101404403
(2R,3R)-1-benzyl-6-oxo-2-phenyl-N,N-di(propan-2-yl)piperidine-3-carboxamide (PubChem CID 101404403) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2R,3R)-1-benzyl-6-oxo-2-phenyl-N,N-di(propan-2-yl)piperidine-3-carboxamide.
| Compound Name | (2R,3R)-1-benzyl-6-oxo-2-phenyl-N,N-di(propan-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 101404403 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | (2R,3R)-1-benzyl-6-oxo-2-phenyl-N,N-di(propan-2-yl)piperidine-3-carboxamide |
| SMILES | CC(C)N(C(=O)[C@@H]1CCC(=O)N(Cc2ccccc2)[C@H]1c1ccccc1)C(C)C |
| InChI | InChI=1S/C25H32N2O2/c1-18(2)27(19(3)4)25(29)22-15-16-23(28)26(17-20-11-7-5-8-12-20)24(22)21-13-9-6-10-14-21/h5-14,18-19,22,24H,15-17H2,1-4H3/t22-,24+/m1/s1 |
| InChIKey | GBULRWRVEFGKRL-VWNXMTODSA-N |
| XLogP | 4.81 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |