C23H28ClN3O2 — CID 119400053
1-benzyl-6-phenyl-5-(piperazine-1-carbonyl)piperidin-2-one;hydrochloride (PubChem CID 119400053) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-benzyl-6-phenyl-5-(piperazine-1-carbonyl)piperidin-2-one;hydrochloride.
| Compound Name | 1-benzyl-6-phenyl-5-(piperazine-1-carbonyl)piperidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119400053 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-benzyl-6-phenyl-5-(piperazine-1-carbonyl)piperidin-2-one;hydrochloride |
| SMILES | Cl.O=C(C1CCC(=O)N(Cc2ccccc2)C1c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C23H27N3O2.ClH/c27-21-12-11-20(23(28)25-15-13-24-14-16-25)22(19-9-5-2-6-10-19)26(21)17-18-7-3-1-4-8-18;/h1-10,20,22,24H,11-17H2;1H |
| InChIKey | VHVUQQRUWCCEFH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |