C26H24N2O3 — CID 102408060
ethyl 2-(4-methylphenyl)-6-oxo-1,3-diphenyl-2H-pyrimidine-4-carboxylate (PubChem CID 102408060) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 2-(4-methylphenyl)-6-oxo-1,3-diphenyl-2H-pyrimidine-4-carboxylate.
| Compound Name | ethyl 2-(4-methylphenyl)-6-oxo-1,3-diphenyl-2H-pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 102408060 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethyl 2-(4-methylphenyl)-6-oxo-1,3-diphenyl-2H-pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=CC(=O)N(c2ccccc2)C(c2ccc(C)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C26H24N2O3/c1-3-31-26(30)23-18-24(29)28(22-12-8-5-9-13-22)25(20-16-14-19(2)15-17-20)27(23)21-10-6-4-7-11-21/h4-18,25H,3H2,1-2H3 |
| InChIKey | RPADFXOUJDBJOG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |