C19H20F3NO5 — CID 100971862
diethyl (3aS,6R)-6-[4-(trifluoromethyl)phenyl]-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate (PubChem CID 100971862) has the molecular formula C19H20F3NO5 and a molecular weight of 399.37 g/mol. Its IUPAC name is diethyl (3aS,6R)-6-[4-(trifluoromethyl)phenyl]-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate.
| Compound Name | diethyl (3aS,6R)-6-[4-(trifluoromethyl)phenyl]-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate |
|---|---|
| PubChem CID | 100971862 |
| Molecular Formula | C19H20F3NO5 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | diethyl (3aS,6R)-6-[4-(trifluoromethyl)phenyl]-3,3a,4,6-tetrahydrocyclopenta[c][1,2]oxazole-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2CON=C2[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3NO5/c1-3-26-16(24)18(17(25)27-4-2)9-12-10-28-23-15(12)14(18)11-5-7-13(8-6-11)19(20,21)22/h5-8,12,14H,3-4,9-10H2,1-2H3/t12-,14+/m1/s1 |
| InChIKey | YOOXHFZZXUCKDB-OCCSQVGLSA-N |
| XLogP | 3.31 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|