C21H21F3O2 — CID 170387451
ethyl 2-methyl-1-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 170387451) has the molecular formula C21H21F3O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl 2-methyl-1-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-methyl-1-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 170387451 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 2-methyl-1-(4-methylphenyl)-3-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(C)cc2)C(C)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3O2/c1-4-26-19(25)20(16-9-5-13(2)6-10-16)14(3)18(20)15-7-11-17(12-8-15)21(22,23)24/h5-12,14,18H,4H2,1-3H3 |
| InChIKey | ZMWYTPUWWLFHFQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |