C18H23N3O4 — CID 113217097
1-(pyridin-4-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea (PubChem CID 113217097) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 1-(pyridin-4-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(pyridin-4-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 113217097 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(pyridin-4-ylmethyl)-3-[2-(3,4,5-trimethoxyphenyl)ethyl]urea |
| SMILES | COc1cc(CCNC(=O)NCc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H23N3O4/c1-23-15-10-14(11-16(24-2)17(15)25-3)6-9-20-18(22)21-12-13-4-7-19-8-5-13/h4-5,7-8,10-11H,6,9,12H2,1-3H3,(H2,20,21,22) |
| InChIKey | VDVXZEKONUEBLQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |