C16H20N2O3S — CID 2954103
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 2954103) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 2954103 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(CCNC(=S)NCc2ccco2)cc1OC |
| InChI | InChI=1S/C16H20N2O3S/c1-19-14-6-5-12(10-15(14)20-2)7-8-17-16(22)18-11-13-4-3-9-21-13/h3-6,9-10H,7-8,11H2,1-2H3,(H2,17,18,22) |
| InChIKey | MYPIFQATZHLIIP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|