C20H17F2N3O4 — CID 35335808
4-(difluoromethoxy)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]benzamide (PubChem CID 35335808) has the molecular formula C20H17F2N3O4 and a molecular weight of 401.37 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 35335808 |
| Molecular Formula | C20H17F2N3O4 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]benzamide |
| SMILES | O=C(NCc1ccco1)Nc1ccc(NC(=O)c2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H17F2N3O4/c21-19(22)29-16-9-3-13(4-10-16)18(26)24-14-5-7-15(8-6-14)25-20(27)23-12-17-2-1-11-28-17/h1-11,19H,12H2,(H,24,26)(H2,23,25,27) |
| InChIKey | CNGGYJVKTXFTAR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |