C21H20N4O4 — CID 134050707
N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-4-[(E)-methoxyiminomethyl]benzamide (PubChem CID 134050707) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-4-[(E)-methoxyiminomethyl]benzamide.
| Compound Name | N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-4-[(E)-methoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 134050707 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-4-[(E)-methoxyiminomethyl]benzamide |
| SMILES | CO/N=C/c1ccc(C(=O)Nc2ccc(NC(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C21H20N4O4/c1-28-23-13-15-4-6-16(7-5-15)20(26)24-17-8-10-18(11-9-17)25-21(27)22-14-19-3-2-12-29-19/h2-13H,14H2,1H3,(H,24,26)(H2,22,25,27)/b23-13+ |
| InChIKey | ZTTDWMZMPJMRLN-YDZHTSKRSA-N |
| XLogP | 3.83 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|