C23H25N3O3 — CID 109046633
4-N-[4-(diethylamino)phenyl]-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 109046633) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)phenyl]-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[4-(diethylamino)phenyl]-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109046633 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 4-N-[4-(diethylamino)phenyl]-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2ccc(C(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-3-26(4-2)20-13-11-19(12-14-20)25-23(28)18-9-7-17(8-10-18)22(27)24-16-21-6-5-15-29-21/h5-15H,3-4,16H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | IKXHOBAJKSZYGB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|