C19H24N2O3 — CID 54789414
N-(furan-2-ylmethyl)-4-(heptanoylamino)benzamide (PubChem CID 54789414) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(heptanoylamino)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(heptanoylamino)benzamide |
|---|---|
| PubChem CID | 54789414 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(heptanoylamino)benzamide |
| SMILES | CCCCCCC(=O)Nc1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-2-3-4-5-8-18(22)21-16-11-9-15(10-12-16)19(23)20-14-17-7-6-13-24-17/h6-7,9-13H,2-5,8,14H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | JSWMZDWAJJWZKB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|