C16H20N3O4+ — CID 8710504
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium (PubChem CID 8710504) has the molecular formula C16H20N3O4+ and a molecular weight of 318.35 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 8710504 |
| Molecular Formula | C16H20N3O4+ |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-(furan-2-ylmethyl)-methylazanium |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH+](C)Cc2ccco2)c1C |
| InChI | InChI=1S/C16H19N3O4/c1-11-6-7-14(19(21)22)16(12(11)2)17-15(20)10-18(3)9-13-5-4-8-23-13/h4-8H,9-10H2,1-3H3,(H,17,20)/p+1 |
| InChIKey | XHPQQUHGWVXFCQ-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|