C15H23N4O4+ — CID 8717795
[2-(dimethylamino)-2-oxoethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8717795) has the molecular formula C15H23N4O4+ and a molecular weight of 323.37 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(dimethylamino)-2-oxoethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8717795 |
| Molecular Formula | C15H23N4O4+ |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl]-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)C[NH+](C)CC(=O)N(C)C)c1C |
| InChI | InChI=1S/C15H22N4O4/c1-10-6-7-12(19(22)23)15(11(10)2)16-13(20)8-18(5)9-14(21)17(3)4/h6-7H,8-9H2,1-5H3,(H,16,20)/p+1 |
| InChIKey | VQXSNXSXSXJWAP-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|