C18H20FN3O3 — CID 8676685
N-(2,3-dimethyl-6-nitrophenyl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 8676685) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is N-(2,3-dimethyl-6-nitrophenyl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 8676685 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[(4-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)CN(C)Cc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C18H20FN3O3/c1-12-4-9-16(22(24)25)18(13(12)2)20-17(23)11-21(3)10-14-5-7-15(19)8-6-14/h4-9H,10-11H2,1-3H3,(H,20,23) |
| InChIKey | JEDWRLQIVXWOAH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|