C17H15FN6O3 — CID 7465847
N-(2,3-dimethyl-6-nitrophenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide (PubChem CID 7465847) has the molecular formula C17H15FN6O3 and a molecular weight of 370.34 g/mol. Its IUPAC name is N-(2,3-dimethyl-6-nitrophenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 7465847 |
| Molecular Formula | C17H15FN6O3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-(2,3-dimethyl-6-nitrophenyl)-2-[5-(4-fluorophenyl)tetrazol-2-yl]acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(=O)Cn2nnc(-c3ccc(F)cc3)n2)c1C |
| InChI | InChI=1S/C17H15FN6O3/c1-10-3-8-14(24(26)27)16(11(10)2)19-15(25)9-23-21-17(20-22-23)12-4-6-13(18)7-5-12/h3-8H,9H2,1-2H3,(H,19,25) |
| InChIKey | XOIFDAAUANBTQR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|