C15H9Cl3N6O3 — CID 1129870
2-[5-(4-nitrophenyl)tetrazol-2-yl]-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 1129870) has the molecular formula C15H9Cl3N6O3 and a molecular weight of 427.64 g/mol. Its IUPAC name is 2-[5-(4-nitrophenyl)tetrazol-2-yl]-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-[5-(4-nitrophenyl)tetrazol-2-yl]-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 1129870 |
| Molecular Formula | C15H9Cl3N6O3 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-[5-(4-nitrophenyl)tetrazol-2-yl]-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccc([N+](=O)[O-])cc2)n1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl3N6O3/c16-9-5-11(17)14(12(18)6-9)19-13(25)7-23-21-15(20-22-23)8-1-3-10(4-2-8)24(26)27/h1-6H,7H2,(H,19,25) |
| InChIKey | GGDHTNRUVPTGSW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|