C16H12BrN7O4 — CID 30834317
N'-[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]-4-nitrobenzohydrazide (PubChem CID 30834317) has the molecular formula C16H12BrN7O4 and a molecular weight of 446.22 g/mol. Its IUPAC name is N'-[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 30834317 |
| Molecular Formula | C16H12BrN7O4 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | N'-[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]-4-nitrobenzohydrazide |
| SMILES | O=C(Cn1nnc(-c2ccc(Br)cc2)n1)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12BrN7O4/c17-12-5-1-10(2-6-12)15-19-22-23(21-15)9-14(25)18-20-16(26)11-3-7-13(8-4-11)24(27)28/h1-8H,9H2,(H,18,25)(H,20,26) |
| InChIKey | HCENJKFUIGTFFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|