C14H16N6O5 — CID 3213442
N-(1,4-dioxan-2-ylmethyl)-2-[5-(4-nitrophenyl)tetrazol-2-yl]acetamide (PubChem CID 3213442) has the molecular formula C14H16N6O5 and a molecular weight of 348.32 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-2-[5-(4-nitrophenyl)tetrazol-2-yl]acetamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-2-[5-(4-nitrophenyl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3213442 |
| Molecular Formula | C14H16N6O5 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-2-[5-(4-nitrophenyl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccc([N+](=O)[O-])cc2)n1)NCC1COCCO1 |
| InChI | InChI=1S/C14H16N6O5/c21-13(15-7-12-9-24-5-6-25-12)8-19-17-14(16-18-19)10-1-3-11(4-2-10)20(22)23/h1-4,12H,5-9H2,(H,15,21) |
| InChIKey | KVMZDMSLEARNSQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|