C18H17BrN6O2 — CID 86874442
4-bromo-N'-[4-(5-phenyltetrazol-2-yl)butanoyl]benzohydrazide (PubChem CID 86874442) has the molecular formula C18H17BrN6O2 and a molecular weight of 429.28 g/mol. Its IUPAC name is 4-bromo-N'-[4-(5-phenyltetrazol-2-yl)butanoyl]benzohydrazide.
| Compound Name | 4-bromo-N'-[4-(5-phenyltetrazol-2-yl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 86874442 |
| Molecular Formula | C18H17BrN6O2 |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-bromo-N'-[4-(5-phenyltetrazol-2-yl)butanoyl]benzohydrazide |
| SMILES | O=C(CCCn1nnc(-c2ccccc2)n1)NNC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrN6O2/c19-15-10-8-14(9-11-15)18(27)22-20-16(26)7-4-12-25-23-17(21-24-25)13-5-2-1-3-6-13/h1-3,5-6,8-11H,4,7,12H2,(H,20,26)(H,22,27) |
| InChIKey | WYFTXHMTKCCZMO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|