C17H25N5O2 — CID 111484159
N-(2-hydroxy-2,3-dimethylbutyl)-4-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 111484159) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)-4-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)-4-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 111484159 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)-4-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | CC(C)C(C)(O)CNC(=O)CCCn1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H25N5O2/c1-13(2)17(3,24)12-18-15(23)10-7-11-22-20-16(19-21-22)14-8-5-4-6-9-14/h4-6,8-9,13,24H,7,10-12H2,1-3H3,(H,18,23) |
| InChIKey | ODTZDEVEEQTPQB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |