C22H23NO5 — CID 9456977
[2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 9456977) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 9456977 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-phenylbutyl]amino]ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | CCC[C@H](NC(=O)COC(=O)Cc1coc2cc(O)ccc12)c1ccccc1 |
| InChI | InChI=1S/C22H23NO5/c1-2-6-19(15-7-4-3-5-8-15)23-21(25)14-28-22(26)11-16-13-27-20-12-17(24)9-10-18(16)20/h3-5,7-10,12-13,19,24H,2,6,11,14H2,1H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | YYWYKBXWKRQFCD-IBGZPJMESA-N |
| XLogP | 3.88 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |