C21H22N2O4 — CID 8985731
[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 8985731) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 2-(1,2-benzoxazol-3-yl)acetate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 2-(1,2-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 8985731 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 2-(1,2-benzoxazol-3-yl)acetate |
| SMILES | CCC[C@@H](NC(=O)COC(=O)Cc1noc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4/c1-2-8-17(15-9-4-3-5-10-15)22-20(24)14-26-21(25)13-18-16-11-6-7-12-19(16)27-23-18/h3-7,9-12,17H,2,8,13-14H2,1H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | SSQSVQMGXPZLCX-QGZVFWFLSA-N |
| XLogP | 3.57 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |