C18H15NO6S — CID 46806072
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 46806072) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 46806072 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCC(=O)NC(=O)c3cccs3)coc2c1 |
| InChI | InChI=1S/C18H15NO6S/c1-23-12-4-5-13-11(9-24-14(13)8-12)7-17(21)25-10-16(20)19-18(22)15-3-2-6-26-15/h2-6,8-9H,7,10H2,1H3,(H,19,20,22) |
| InChIKey | OAQNOJVEWCHJFX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |